| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:50:53 UTC |
|---|
| Update Date | 2025-03-25 00:50:23 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02180531 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H26O3 |
|---|
| Molecular Mass | 326.1882 |
|---|
| SMILES | COc1ccc(C(C)C(C)(C)c2ccc(C(C)C(=O)O)cc2)cc1 |
|---|
| InChI Key | UCXRTCBOECRKER-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | stilbenes |
|---|
| Subclass | stilbenes |
|---|
| Direct Parent | stilbenes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisolesaromatic monoterpenoidscarbonyl compoundscarboxylic acidshydrocarbon derivativesmethoxybenzenesmonocarboxylic acids and derivativesmonocyclic monoterpenoidsorganic oxidesphenoxy compoundsphenylpropanesphenylpropanoic acids |
|---|
| Substituents | monoterpenoidphenol ethermonocyclic benzene moietycarbonyl groupmonocyclic monoterpenoidethercarboxylic acidp-cymenealkyl aryl ethercarboxylic acid derivativephenylpropaneorganic oxide2-phenylpropanoic-acidmethoxybenzenearomatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundanisolehydrocarbon derivativebenzenoidphenoxy compoundorganooxygen compoundaromatic monoterpenoidstilbene |
|---|