| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:50:54 UTC |
|---|
| Update Date | 2025-03-25 00:50:23 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02180592 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H22N2O |
|---|
| Molecular Mass | 270.1732 |
|---|
| SMILES | COc1ccc(C(CCN(C)C)c2ccccc2)cn1 |
|---|
| InChI Key | AGYRJFALDLOWJH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyridines and derivatives |
|---|
| Subclass | halopyridines |
|---|
| Direct Parent | polyhalopyridines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 2-halopyridinesalkyl aryl ethersazacyclic compoundsbenzene and substituted derivativesheteroaromatic compoundshydrocarbon derivativesmethylpyridinesorganopnictogen compoundstrialkylamines |
|---|
| Substituents | monocyclic benzene moietyetheraromatic heteromonocyclic compoundazacyclepolyhalopyridineheteroaromatic compoundtertiary aliphatic aminemethylpyridinealkyl aryl etherorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoid2-halopyridineorganic nitrogen compoundaminetertiary amineorganooxygen compound |
|---|
