| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:50:54 UTC |
|---|
| Update Date | 2025-03-25 00:50:23 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02180597 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H25NO4 |
|---|
| Molecular Mass | 307.1784 |
|---|
| SMILES | COc1ccc(C(CN(C)C(=O)O)C2(O)CCCCC2)cc1 |
|---|
| InChI Key | WLZUSXXQVVBARO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenol ethers |
|---|
| Subclass | anisoles |
|---|
| Direct Parent | anisoles |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl etherscarbamic acidscarbonyl compoundscyclic alcohols and derivativescyclohexanolshydrocarbon derivativesmethoxybenzenesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenoxy compoundstertiary alcohols |
|---|
| Substituents | alcoholmonocyclic benzene moietycarbonyl groupethercarbonic acid derivativecarbamic acidcyclohexanolcyclic alcoholalkyl aryl ethermethoxybenzenearomatic homomonocyclic compoundtertiary alcoholorganic oxideorganic oxygen compoundanisoleorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundphenoxy compoundorganooxygen compound |
|---|
