| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:50:55 UTC |
|---|
| Update Date | 2025-03-25 00:50:23 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02180608 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H18O3 |
|---|
| Molecular Mass | 282.1256 |
|---|
| SMILES | Cc1c(C)c2c(c(C)c1O)C(=O)C(c1ccccc1)CO2 |
|---|
| InChI Key | WLCLATWSOZDZFH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | isoflavonoids |
|---|
| Subclass | isoflavans |
|---|
| Direct Parent | isoflavanones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersaryl alkyl ketonesbenzene and substituted derivativeschromoneshydrocarbon derivativesorganic oxidesoxacyclic compounds |
|---|
| Substituents | monocyclic benzene moietyetherbenzopyranaryl alkyl ketone1-benzopyranalkyl aryl etherisoflavanoneketoneoxacycleorganic oxideorganic oxygen compoundchromonearomatic heteropolycyclic compoundchromanehydrocarbon derivativebenzenoidorganoheterocyclic compoundorganooxygen compoundaryl ketone |
|---|
