| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:50:55 UTC |
|---|
| Update Date | 2025-03-25 00:50:23 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02180616 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H16N2O3 |
|---|
| Molecular Mass | 260.1161 |
|---|
| SMILES | COc1cc(NC(C)=O)ccc1NCc1ccco1 |
|---|
| InChI Key | XGXVUGMHTWFTTF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | acetanilides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesalkyl aryl ethersamino acids and derivativesanisolescarbonyl compoundscarboxylic acids and derivativesfuransheteroaromatic compoundshydrocarbon derivativesmethoxybenzenesn-acetylarylaminesorganic oxidesorganopnictogen compoundsoxacyclic compoundsphenoxy compoundsphenylalkylaminessecondary alkylarylaminessecondary carboxylic acid amides |
|---|
| Substituents | furanphenol ethercarbonyl groupethern-acetylarylaminearomatic heteromonocyclic compoundamino acid or derivativesn-arylamidealkyl aryl ethercarboxylic acid derivativeorganic oxideorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundacetamideacetanilideheteroaromatic compoundsecondary aminecarboxamide groupmethoxybenzenesecondary aliphatic/aromatic amineoxacyclesecondary carboxylic acid amideorganic oxygen compoundanisolephenylalkylaminehydrocarbon derivativeorganic nitrogen compoundphenoxy compoundamineorganooxygen compound |
|---|
