| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:50:57 UTC |
|---|
| Update Date | 2025-03-25 00:50:24 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02180694 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H20N4O4 |
|---|
| Molecular Mass | 392.1485 |
|---|
| SMILES | COc1cc(CCn2c3nc(=O)[nH]c(=O)c-3nc3cc(C)c(C)cc32)ccc1O |
|---|
| InChI Key | OQUBJQGDYMMLPX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | alloxazines and isoalloxazines |
|---|
| Direct Parent | flavins |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalkyl aryl ethersanisolesazacyclic compoundsdiazanaphthalenesheteroaromatic compoundshydrocarbon derivativeslactamsmethoxybenzenesmethoxyphenolsorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenoxy compoundspyrazinespyrimidonesquinoxalines |
|---|
| Substituents | phenol ethermonocyclic benzene moietyetherlactam1-hydroxy-2-unsubstituted benzenoidmethoxyphenolpyrimidonealkyl aryl etherflavinpyrimidineorganic oxidediazanaphthalenearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundquinoxalinecarbonic acid derivativeazacycleheteroaromatic compoundmethoxybenzeneorganic oxygen compoundanisolepyrazinephenolhydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compoundorganooxygen compound |
|---|
