| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:50:58 UTC |
|---|
| Update Date | 2025-03-25 00:50:24 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02180709 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H19NO8 |
|---|
| Molecular Mass | 329.1111 |
|---|
| SMILES | Cc1c(CC(=O)O)c(C(=O)O)c(C)n1C1OC(CO)C(O)C1O |
|---|
| InChI Key | FHUCNIJAJDTNGA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyrroles |
|---|
| Subclass | pyrrole carboxylic acids and derivatives |
|---|
| Direct Parent | pyrrole carboxylic acids |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compoundsazacyclic compoundscarbonyl compoundsdicarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary alcoholssecondary alcoholssubstituted pyrrolestetrahydrofuransvinylogous amides |
|---|
| Substituents | carbonyl groupcarboxylic acidaromatic heteromonocyclic compoundmonosaccharidesubstituted pyrrolecarboxylic acid derivativesaccharideorganic oxideorganonitrogen compoundorganopnictogen compound1-carboxy-2-haloaromatic compoundprimary alcoholalcoholvinylogous amideazacycletetrahydrofuranheteroaromatic compoundoxacycleorganic oxygen compoundsecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativeorganic nitrogen compoundpyrrole-3-carboxylic acidorganooxygen compound |
|---|
