| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:50:59 UTC |
|---|
| Update Date | 2025-03-25 00:50:25 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02180775 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H16FNO2 |
|---|
| Molecular Mass | 297.1165 |
|---|
| SMILES | Cc1c(-c2ccc(F)cc2)n(CCC(=O)O)c2ccccc12 |
|---|
| InChI Key | OGZOMSRNRWFTPX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | n-alkylindoles |
|---|
| Direct Parent | n-alkylindoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 3-methylindolesaryl fluoridesazacyclic compoundscarbonyl compoundscarboxylic acidsfluorobenzenesheteroaromatic compoundshydrocarbon derivativesindolesmonocarboxylic acids and derivativesorganic oxidesorganofluoridesorganonitrogen compoundsorganopnictogen compoundssubstituted pyrroles |
|---|
| Substituents | aryl fluoride3-methylindolemonocyclic benzene moietycarbonyl groupn-alkylindolecarboxylic acidindolesubstituted pyrrolecarboxylic acid derivativeorganohalogen compoundfluorobenzeneorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundazacycleorganofluorideheteroaromatic compoundaryl halidemonocarboxylic acid or derivativesorganic oxygen compoundpyrrolehydrocarbon derivativebenzenoidorganic nitrogen compoundhalobenzeneorganooxygen compound |
|---|