| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:50:59 UTC |
|---|
| Update Date | 2025-03-25 00:50:25 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02180782 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H13NO6S |
|---|
| Molecular Mass | 275.0464 |
|---|
| SMILES | COc1cc(OS(C)(=O)=O)ccc1NC(=O)CO |
|---|
| InChI Key | PRCVSYARVOZTCF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | anilides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alcohols and polyolsalkyl aryl ethersanisolescarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesmethanesulfonatesmethoxybenzenesn-arylamidesorganic oxidesorganopnictogen compoundsorganosulfonic acid estersphenoxy compoundssecondary carboxylic acid amidessulfonic acid esterssulfonyls |
|---|
| Substituents | phenol etherorganosulfonic acid or derivativescarbonyl groupethern-arylamidealkyl aryl etherorganosulfur compoundcarboxylic acid derivativesulfonic acid esterorganic oxideorganonitrogen compoundorganopnictogen compoundalcoholcarboxamide groupmethoxybenzeneorganosulfonic acid esteraromatic homomonocyclic compoundanilidemethanesulfonatesecondary carboxylic acid amidesulfonylorganic oxygen compoundorganic sulfonic acid or derivativesanisolehydrocarbon derivativeorganic nitrogen compoundphenoxy compoundorganooxygen compound |
|---|