| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:51:03 UTC |
|---|
| Update Date | 2025-03-25 00:50:26 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02180933 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C23H27NO5 |
|---|
| Molecular Mass | 397.1889 |
|---|
| SMILES | O=C(O)CCC(C(=O)O)N1CCC(C(O)(c2ccccc2)c2ccccc2)CC1 |
|---|
| InChI Key | WFVONLMGQZKRLV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | glutamic acid and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsamino acidsamino fatty acidsaromatic alcoholsazacyclic compoundscarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativesdiphenylmethanesfatty acylshydrocarbon derivativeshydroxy fatty acidsorganic oxidesorganopnictogen compoundspiperidinestertiary alcoholstrialkylamines |
|---|
| Substituents | aromatic alcoholfatty acyldiphenylmethanemonocyclic benzene moietycarbonyl groupcarboxylic acidaromatic heteromonocyclic compoundamino acidorganic oxidealpha-amino acidorganonitrogen compoundorganopnictogen compoundhydroxy fatty acidpiperidinetertiary amineorganoheterocyclic compoundalcoholazacycletertiary aliphatic amineglutamic acid or derivativesamino fatty acidtertiary alcoholorganic oxygen compounddicarboxylic acid or derivativeshydrocarbon derivativebenzenoidorganic nitrogen compoundamineorganooxygen compound |
|---|
