| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:51:03 UTC |
|---|
| Update Date | 2025-03-25 00:50:26 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02180937 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H9O9P |
|---|
| Molecular Mass | 255.9984 |
|---|
| SMILES | O=C(O)CCC(C(=O)O)C(=O)OP(=O)(O)O |
|---|
| InChI Key | AAJTZDYUDYOHSL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | tricarboxylic acids and derivatives |
|---|
| Direct Parent | tricarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | 1,3-dicarbonyl compoundsacyl monophosphatescarboxylic acidshydrocarbon derivativesorganic oxidesorganic phosphoric acids and derivatives |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidacyl monophosphatetricarboxylic acid or derivativesorganic oxideorganic oxygen compoundhydrocarbon derivative1,3-dicarbonyl compoundorganic phosphoric acid derivativeorganooxygen compoundacyl phosphate |
|---|
