| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:51:03 UTC |
|---|
| Update Date | 2025-03-25 00:50:26 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02180938 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H17NO6 |
|---|
| Molecular Mass | 295.1056 |
|---|
| SMILES | O=C(O)CCC(C(=O)O)N(CC(=O)O)Cc1ccccc1 |
|---|
| InChI Key | PUIOFUBWKPEWLU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | glutamic acid and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsamino acidsamino fatty acidsaralkylaminesbenzylaminescarbonyl compoundscarboxylic acidsfatty acylshydrocarbon derivativesorganic oxidesorganopnictogen compoundsphenylmethylaminestrialkylaminestricarboxylic acids and derivatives |
|---|
| Substituents | fatty acylmonocyclic benzene moietycarbonyl groupcarboxylic acidamino acidtricarboxylic acid or derivativesaralkylamineorganic oxidealpha-amino acidorganonitrogen compoundorganopnictogen compoundtertiary aminetertiary aliphatic amineglutamic acid or derivativesamino fatty acidaromatic homomonocyclic compoundphenylmethylamineorganic oxygen compoundbenzylaminehydrocarbon derivativebenzenoidorganic nitrogen compoundamineorganooxygen compound |
|---|
