| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:51:04 UTC |
|---|
| Update Date | 2025-03-25 00:50:27 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02180974 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H14N2O5S |
|---|
| Molecular Mass | 274.0623 |
|---|
| SMILES | O=C(O)CCC1SCC2C(=O)NC(CO)C(=O)N12 |
|---|
| InChI Key | WFIDVIBLCSATPG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | peptidomimetics |
|---|
| Subclass | hybrid peptides |
|---|
| Direct Parent | hybrid peptides |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | 2,5-dioxopiperazinesalpha amino acidsazacyclic compoundscarbonyl compoundscarboxylic acidsdialkylthioethersfatty acylshydrocarbon derivativeshydroxy fatty acidslactamsmonocarboxylic acids and derivativesn-alkylpiperazinesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsprimary alcoholssecondary carboxylic acid amidestertiary carboxylic acid amidesthia fatty acidsthiazolidinesthiohemiaminal derivatives |
|---|
| Substituents | fatty acylcarbonyl grouplactamcarboxylic acidalpha-amino acid or derivatives2,5-dioxopiperazinecarboxylic acid derivativealiphatic heteropolycyclic compoundorganic oxidedioxopiperazinepiperazinetertiary carboxylic acid amideorganonitrogen compoundalpha-amino acidhemithioaminalorganopnictogen compoundhydroxy fatty acidprimary alcoholorganoheterocyclic compoundalcoholazacycledialkylthioethern-alkylpiperazinecarboxamide groupsecondary carboxylic acid amidemonocarboxylic acid or derivativesthia fatty acidorganic oxygen compoundthioether1,4-diazinanehybrid peptidehydrocarbon derivativeorganic nitrogen compoundorganooxygen compoundthiazolidine |
|---|