| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:51:05 UTC |
|---|
| Update Date | 2025-03-25 00:50:27 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02180999 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H10O6 |
|---|
| Molecular Mass | 202.0477 |
|---|
| SMILES | O=C(O)CCC1(C(=O)O)CC1C(=O)O |
|---|
| InChI Key | DZKUBMXSILYUBA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty acids and conjugates |
|---|
| Direct Parent | carbocyclic fatty acids |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidscyclopropanecarboxylic acidsfatty acylshydrocarbon derivativesorganic oxidestricarboxylic acids and derivatives |
|---|
| Substituents | carbocyclic fatty acidcarbonyl groupcarboxylic acidcyclopropanecarboxylic acid or derivativestricarboxylic acid or derivativescarboxylic acid derivativeorganic oxideorganic oxygen compoundaliphatic homomonocyclic compoundhydrocarbon derivativecyclopropanecarboxylic acidorganooxygen compound |
|---|
