| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:51:07 UTC |
|---|
| Update Date | 2025-03-25 00:50:28 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02181066 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H14O9 |
|---|
| Molecular Mass | 266.0638 |
|---|
| SMILES | O=C(O)CC(O)C1(O)CC(O)C(O)C(C(=O)O)O1 |
|---|
| InChI Key | YHBMJEAZQBWOKZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | c-glucuronides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | beta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativeshemiacetalshydrocarbon derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanespyran carboxylic acidssecondary alcohols |
|---|
| Substituents | c-glucuronidealcoholcarbonyl groupcarboxylic acidpyran carboxylic acid or derivativesmonosaccharidehydroxy acidcarboxylic acid derivativepyran carboxylic acidoxacyclebeta-hydroxy acidorganic oxidepyranaliphatic heteromonocyclic compoundsecondary alcoholdicarboxylic acid or derivativeshemiacetalhydrocarbon derivativeoxaneorganoheterocyclic compound |
|---|
