Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:51:08 UTC |
---|
Update Date | 2025-03-25 00:50:28 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02181117 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C19H19NO6 |
---|
Molecular Mass | 357.1212 |
---|
SMILES | O=C(O)CC(NC(=O)COC(c1ccccc1)c1ccccc1)C(=O)O |
---|
InChI Key | ICZJDHXKXUOCDW-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic acids and derivatives |
---|
Class | carboxylic acids and derivatives |
---|
Subclass | amino acids, peptides, and analogues |
---|
Direct Parent | aspartic acid and derivatives |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | alpha amino acidsbenzyletherscarbonyl compoundscarboxylic acidsdialkyl ethersdicarboxylic acids and derivativesdiphenylmethaneshydrocarbon derivativesn-acyl-alpha amino acidsorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary carboxylic acid amides |
---|
Substituents | diphenylmethanemonocyclic benzene moietycarbonyl groupethercarboxylic acidbenzyletherdialkyl etherorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundn-acyl-alpha amino acid or derivativesn-acyl-alpha-amino acidcarboxamide grouparomatic homomonocyclic compoundsecondary carboxylic acid amideorganic oxygen compoundaspartic acid or derivativesdicarboxylic acid or derivativeshydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
---|