| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:51:12 UTC |
|---|
| Update Date | 2025-03-25 00:50:29 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02181274 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H17N3O6 |
|---|
| Molecular Mass | 299.1117 |
|---|
| SMILES | O=C(O)CN=C(O)CCCC=C1CC(C(=O)O)NC(=O)N1 |
|---|
| InChI Key | UIDNOBDBHVFHFY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarbonyl compoundscarboximidic acidscarboxylic acidsdiazinanesdicarboxylic acids and derivativeshydrocarbon derivativesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspropargyl-type 1,3-dipolar organic compoundspyrimidones |
|---|
| Substituents | carboximidic acidcarbonyl groupcarbonic acid derivativecarboxylic acidazacyclepyrimidoneorganic 1,3-dipolar compoundpyrimidinepropargyl-type 1,3-dipolar organic compound1,3-diazinaneorganic oxideorganic oxygen compoundaliphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino aciddicarboxylic acid or derivativesorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganoheterocyclic compoundorganooxygen compound |
|---|
