Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:51:13 UTC |
---|
Update Date | 2025-03-25 00:50:30 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02181322 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C9H13NO4S |
---|
Molecular Mass | 231.0565 |
---|
SMILES | O=C(O)CCc1c[nH]cc1CCS(=O)O |
---|
InChI Key | DMZUPFQYGRJUOT-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organoheterocyclic compounds |
---|
Class | heteroaromatic compounds |
---|
Subclass | heteroaromatic compounds |
---|
Direct Parent | heteroaromatic compounds |
---|
Geometric Descriptor | aromatic heteromonocyclic compounds |
---|
Alternative Parents | alkanesulfinic acids and derivativesazacyclic compoundscarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsorganosulfur compoundspyrrolessulfinic acids |
---|
Substituents | carbonyl groupcarboxylic acidaromatic heteromonocyclic compoundazacyclesulfinic acid derivativeheteroaromatic compoundorganosulfur compoundcarboxylic acid derivativesulfinic acidalkanesulfinic acid or derivativesorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundpyrroleorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
---|