| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:51:14 UTC |
|---|
| Update Date | 2025-03-25 00:50:30 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02181336 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H10O6S |
|---|
| Molecular Mass | 258.0198 |
|---|
| SMILES | O=C(O)CCc1scc(C(=O)O)c1CC(=O)O |
|---|
| InChI Key | OFYPIWJHAYBHFD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | tricarboxylic acids and derivatives |
|---|
| Direct Parent | tricarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compoundscarbonyl compoundsheteroaromatic compoundshydrocarbon derivativesorganic oxidesthiophene carboxylic acids |
|---|
| Substituents | carbonyl groupcarboxylic acidaromatic heteromonocyclic compoundthiophene carboxylic acidheteroaromatic compoundtricarboxylic acid or derivativesthiophenethiophene carboxylic acid or derivativesorganic oxideorganic oxygen compoundhydrocarbon derivative1-carboxy-2-haloaromatic compoundorganoheterocyclic compoundorganooxygen compound |
|---|
