| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:51:14 UTC |
|---|
| Update Date | 2025-03-25 00:50:30 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02181352 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H20NO9P |
|---|
| Molecular Mass | 401.0876 |
|---|
| SMILES | O=C(O)CCc1cn(C2OC(COP(=O)(O)O)C(O)C2O)c2ccccc12 |
|---|
| InChI Key | METCFSYIDRVNDC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | indole ribonucleosides and ribonucleotides |
|---|
| Subclass | indole ribonucleosides and ribonucleotides |
|---|
| Direct Parent | indole ribonucleosides and ribonucleotides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diolsazacyclic compoundsbenzenoidscarbonyl compoundscarboxylic acidsheteroaromatic compoundshydrocarbon derivativesindolesmonoalkyl phosphatesmonocarboxylic acids and derivativesmonosaccharidesn-alkylindolesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundspentose phosphatessecondary alcoholssubstituted pyrrolestetrahydrofurans |
|---|
| Substituents | carbonyl groupn-alkylindolecarboxylic acidpentose phosphateindolemonosaccharidepentose-5-phosphatesubstituted pyrrole1-ribofuranosylindolecarboxylic acid derivativesaccharideorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compound1,2-diolalcoholazacycletetrahydrofuranheteroaromatic compoundindole or derivativesoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundphosphoric acid estermonoalkyl phosphatepyrrolesecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|
