| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:51:15 UTC |
|---|
| Update Date | 2025-03-25 00:50:31 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02181394 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H8O7 |
|---|
| Molecular Mass | 264.027 |
|---|
| SMILES | O=C(O)COc1ccc2oc(C(=O)O)cc(=O)c2c1 |
|---|
| InChI Key | JOYQFCCXRMDAAL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | benzopyrans |
|---|
| Subclass | 1-benzopyrans |
|---|
| Direct Parent | chromones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl etherscarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativesorganic oxidesoxacyclic compoundsphenol ethersphenoxyacetic acid derivativespyranones and derivatives |
|---|
| Substituents | phenol etherphenoxyacetatecarbonyl groupethercarboxylic acidheteroaromatic compoundalkyl aryl ethercarboxylic acid derivativeoxacycleorganic oxideorganic oxygen compoundchromonearomatic heteropolycyclic compoundpyranpyranonedicarboxylic acid or derivativeshydrocarbon derivativebenzenoidorganooxygen compound |
|---|
