| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:51:16 UTC |
|---|
| Update Date | 2025-03-25 00:50:31 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02181420 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H14N2O2 |
|---|
| Molecular Mass | 254.1055 |
|---|
| SMILES | OC1=NC(O)(c2ccccc2)C(c2ccccc2)N1 |
|---|
| InChI Key | MFOGUWUYCODASR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | stilbenes |
|---|
| Subclass | stilbenes |
|---|
| Direct Parent | stilbenes |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkanolaminesazacyclic compoundsbenzene and substituted derivativescarbonyl compoundshydrocarbon derivativesimidazolidinonesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenylhydantoinsphenylimidazolidines |
|---|
| Substituents | imidazolidinemonocyclic benzene moietycarbonyl group5-phenylhydantoincarbonic acid derivativephenylimidazolidinearomatic heteromonocyclic compoundazacycleimidazolidinoneorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundorganoheterocyclic compoundorganooxygen compoundalkanolaminestilbene |
|---|
