| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:51:18 UTC |
|---|
| Update Date | 2025-03-25 00:50:31 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02181499 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H24O5 |
|---|
| Molecular Mass | 272.1624 |
|---|
| SMILES | O=C(O)CCCCCCCCCC(=O)CCC(=O)O |
|---|
| InChI Key | PQAGXUSANLGTEG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty acids and conjugates |
|---|
| Direct Parent | long-chain fatty acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carboxylic acidsdicarboxylic acids and derivativesgamma-keto acids and derivativeshydrocarbon derivativesketo fatty acidsketonesorganic oxides |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl grouplong-chain fatty acidcarboxylic acidketo fatty acidcarboxylic acid derivativegamma-keto acidketoneorganic oxideorganic oxygen compoundketo aciddicarboxylic acid or derivativeshydrocarbon derivativeorganooxygen compound |
|---|