| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:51:22 UTC |
|---|
| Update Date | 2025-03-25 00:50:33 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02181658 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H22O12 |
|---|
| Molecular Mass | 370.1111 |
|---|
| SMILES | O=C(O)C1(O)CC(OC2C(CO)OC(O)(CO)C(O)C2O)C(CO)O1 |
|---|
| InChI Key | CEILIMPOBUGWJA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | monosaccharides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativescarbonyl compoundscarboxylic acidsdialkyl ethershemiacetalshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundsoxanesprimary alcoholssecondary alcoholstetrahydrofurans |
|---|
| Substituents | alcoholcarbonyl groupethercarboxylic acidtetrahydrofuranalpha-hydroxy acidmonosaccharidehydroxy acidcarboxylic acid derivativedialkyl etheroxacycleorganic oxidemonocarboxylic acid or derivativesaliphatic heteromonocyclic compoundsecondary alcoholhemiacetalhydrocarbon derivativeoxaneprimary alcoholorganoheterocyclic compound |
|---|
