| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:51:24 UTC |
|---|
| Update Date | 2025-03-25 00:50:33 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02181716 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H17NO6 |
|---|
| Molecular Mass | 307.1056 |
|---|
| SMILES | O=C(O)C1(O)CC(O)C(O)C(Oc2ccc3[nH]ccc3c2)C1 |
|---|
| InChI Key | HKESXLNUYNFSMJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | quinic acids and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersalpha hydroxy acids and derivativesazacyclic compoundscarbonyl compoundscarboxylic acidscyclohexanolsheteroaromatic compoundshydrocarbon derivativesindolesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenol etherspyrrolestertiary alcohols |
|---|
| Substituents | phenol ethercarbonyl groupethercarboxylic acidindolealpha-hydroxy acidalkyl aryl ethercarboxylic acid derivativeorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundazacycleheteroaromatic compoundcyclohexanolindole or derivativeshydroxy acidtertiary alcoholmonocarboxylic acid or derivativespyrrolesecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundquinic acid |
|---|