| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:51:24 UTC |
|---|
| Update Date | 2025-03-25 00:50:34 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02181730 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H22O15 |
|---|
| Molecular Mass | 430.0959 |
|---|
| SMILES | O=C(O)C1(O)CC(C(O)CO)OC(OCC2OC(O)C(O)C(O)C2O)(C(=O)O)O1 |
|---|
| InChI Key | DSHKSAKIIWOZJZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | orthocarboxylic acid derivatives |
|---|
| Subclass | carboxylic acid orthoesters |
|---|
| Direct Parent | carboxylic acid orthoesters |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,3-dioxanesalpha hydroxy acids and derivativescarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativeshemiacetalshydrocarbon derivativesmonosaccharidesorganic oxidesortho estersoxacyclic compoundsoxanesprimary alcoholssecondary alcohols |
|---|
| Substituents | carbonyl groupcarboxylic acidortho esteralpha-hydroxy acidmonosaccharidecarboxylic acid orthoestercarboxylic acid derivativesaccharideorganic oxidealiphatic heteromonocyclic compoundhemiacetaloxaneprimary alcoholorganoheterocyclic compoundalcoholhydroxy acidoxacycleorganic oxygen compoundsecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativemeta-dioxaneorganooxygen compound |
|---|