| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:51:25 UTC |
|---|
| Update Date | 2025-03-25 00:50:34 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02181752 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C23H32O6 |
|---|
| Molecular Mass | 404.2199 |
|---|
| SMILES | OCC(Cc1cccc(O)c1)C(CO)CC(CO)C(CO)Cc1cccc(O)c1 |
|---|
| InChI Key | RQWUQEGXDBWBJH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | diarylheptanoids |
|---|
| Subclass | linear diarylheptanoids |
|---|
| Direct Parent | linear diarylheptanoids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzene and substituted derivativesfatty alcoholshydrocarbon derivativesprimary alcohols |
|---|
| Substituents | alcoholfatty acylmonocyclic benzene moiety1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidaromatic homomonocyclic compoundorganic oxygen compoundfatty alcohollinear 1,7-diphenylheptane skeletonphenolhydrocarbon derivativebenzenoidprimary alcoholorganooxygen compound |
|---|
