| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:51:25 UTC |
|---|
| Update Date | 2025-03-25 00:50:34 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02181770 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H14Cl2O3 |
|---|
| Molecular Mass | 336.032 |
|---|
| SMILES | O=C(O)C1CC(O)c2ccccc2C1c1ccc(Cl)c(Cl)c1 |
|---|
| InChI Key | ZCDGKWXDEZHIOS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | naphthalenecarboxylic acids and derivatives |
|---|
| Direct Parent | naphthalenecarboxylic acids |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | aryl chloridescarbonyl compoundscarboxylic acidsdichlorobenzeneshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganochloridessecondary alcoholstetralins |
|---|
| Substituents | aryl chloridechlorobenzenealcoholtetralinmonocyclic benzene moietycarbonyl groupcarboxylic acidorganochloridearomatic homopolycyclic compoundcarboxylic acid derivativeorganohalogen compoundaryl halideorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivative1,2-dichlorobenzenehalobenzene2-naphthalenecarboxylic acidorganooxygen compound |
|---|