| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:51:26 UTC |
|---|
| Update Date | 2025-03-25 00:50:34 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02181795 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H12O7 |
|---|
| Molecular Mass | 220.0583 |
|---|
| SMILES | O=C(O)C1=CC(O)C(O)C(O)C(CO)O1 |
|---|
| InChI Key | ITGWRMDRNJPQCO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | secondary alcohols |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundsprimary alcohols |
|---|
| Substituents | carbonyl groupcarboxylic acidcarboxylic acid derivativeoxacycleorganic oxidemonocarboxylic acid or derivativesaliphatic heteromonocyclic compoundsecondary alcoholhydrocarbon derivativeprimary alcoholorganoheterocyclic compound |
|---|