| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:51:27 UTC |
|---|
| Update Date | 2025-03-25 00:50:35 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02181829 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H13O12P |
|---|
| Molecular Mass | 332.0145 |
|---|
| SMILES | O=C(O)C(=O)OP(=O)(O)OCC1OC(O)C(O)C(O)C1O |
|---|
| InChI Key | BUBKZVCWQGGMSD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | hexose phosphates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acyl phosphatescarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativeshemiacetalshydrocarbon derivativesmonoalkyl phosphatesmonosaccharidesorganic oxidesoxacyclic compoundsoxanessecondary alcohols |
|---|
| Substituents | alcoholcarbonyl groupcarboxylic acidcarboxylic acid derivativeoxacycleorganic oxidephosphoric acid estermonoalkyl phosphatealiphatic heteromonocyclic compoundsecondary alcoholhexose phosphatedicarboxylic acid or derivativeshemiacetalhydrocarbon derivativeoxaneorganic phosphoric acid derivativealkyl phosphateorganoheterocyclic compoundacyl phosphate |
|---|
