| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:51:29 UTC |
|---|
| Update Date | 2025-03-25 00:50:35 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02181890 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H8ClNO4 |
|---|
| Molecular Mass | 265.0142 |
|---|
| SMILES | O=C(Nc1c(Cl)cccc1C(=O)O)c1ccco1 |
|---|
| InChI Key | BVLFVGDPCLLFRF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | 2-furanilides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compounds2-heteroaryl carboxamides3-halobenzoic acidsaryl chloridesbenzoic acidsbenzoyl derivativeschlorobenzenesfuroic acid and derivativeshalobenzoic acidsheteroaromatic compoundshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganochloridesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundsoxacyclic compoundssecondary carboxylic acid amidesvinylogous amides |
|---|
| Substituents | furancarboxylic acidaromatic heteromonocyclic compound3-halobenzoic acid or derivativesorganochloridebenzoylcarboxylic acid derivativeorganohalogen compound2-heteroaryl carboxamideorganic oxide3-halobenzoic acid2-furanilideorganonitrogen compoundorganopnictogen compound1-carboxy-2-haloaromatic compoundbenzoic acidorganoheterocyclic compoundaryl chloridechlorobenzenevinylogous amidehalobenzoic acidfuroic acid or derivativesheteroaromatic compoundbenzoic acid or derivativeshalobenzoic acid or derivativescarboxamide grouparyl halideoxacyclesecondary carboxylic acid amidemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundhalobenzeneorganooxygen compound |
|---|