| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:51:29 UTC |
|---|
| Update Date | 2025-03-25 00:50:35 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02181894 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H13NO5S |
|---|
| Molecular Mass | 259.0514 |
|---|
| SMILES | O=C(NC1OC(CO)C(O)C1O)c1cccs1 |
|---|
| InChI Key | UOJJPSDNDCTDLY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | thiophenes |
|---|
| Subclass | thiophene carboxylic acids and derivatives |
|---|
| Direct Parent | thiophene carboxamides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 2-heteroaryl carboxamidescarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary alcoholssecondary alcoholssecondary carboxylic acid amidestetrahydrofurans |
|---|
| Substituents | aromatic heteromonocyclic compoundmonosaccharidecarboxylic acid derivativethiophene carboxamide2-heteroaryl carboxamidesaccharideorganic oxideorganonitrogen compoundorganopnictogen compoundprimary alcoholalcoholtetrahydrofuranheteroaromatic compoundcarboxamide groupoxacyclesecondary carboxylic acid amideorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
