| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:51:30 UTC |
|---|
| Update Date | 2025-03-25 00:50:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02181947 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H16O4 |
|---|
| Molecular Mass | 296.1049 |
|---|
| SMILES | O=C(O)C(O)CCOc1cccc2ccc3ccccc3c12 |
|---|
| InChI Key | CEGVCKRUAGOLLE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenanthrenes and derivatives |
|---|
| Subclass | phenanthrenes and derivatives |
|---|
| Direct Parent | phenanthrenes and derivatives |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersalpha hydroxy acids and derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesnaphthalenesorganic oxidesphenol etherssecondary alcohols |
|---|
| Substituents | alcoholphenol etherphenanthrenecarbonyl groupethercarboxylic acidalpha-hydroxy acidmonosaccharidearomatic homopolycyclic compoundhydroxy acidalkyl aryl ethercarboxylic acid derivativesaccharideorganic oxidemonocarboxylic acid or derivativesnaphthaleneorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganooxygen compound |
|---|
