| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:51:32 UTC |
|---|
| Update Date | 2025-03-25 00:50:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02182008 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H7F6NO5S |
|---|
| Molecular Mass | 366.9949 |
|---|
| SMILES | O=C(O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)Nc1ccccc1O |
|---|
| InChI Key | XBJMJLYTAMHOGN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | sulfanilides |
|---|
| Direct Parent | sulfanilides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalkyl fluoridesalpha-halocarboxylic acidsaminosulfonyl compoundscarbonyl compoundscarboxylic acidsfatty acylshalogenated fatty acidshydrocarbon derivativeshydroxy fatty acidsmonocarboxylic acids and derivativesorganic oxidesorganic sulfonamidesorganofluoridesorganonitrogen compoundsorganopnictogen compoundsorganosulfonamidesthia fatty acids |
|---|
| Substituents | alpha-halocarboxylic acid or derivativesfatty acylorganosulfonic acid or derivativescarbonyl groupcarboxylic acid1-hydroxy-2-unsubstituted benzenoidalpha-halocarboxylic acidorganosulfur compoundcarboxylic acid derivativeorganohalogen compoundorganosulfonic acid amideorganic oxideorganonitrogen compoundorganopnictogen compoundalkyl halidehydroxy fatty acidhalogenated fatty acidaminosulfonyl compoundalkyl fluorideorganofluoride1-hydroxy-4-unsubstituted benzenoidaromatic homomonocyclic compoundsulfanilidemonocarboxylic acid or derivativesthia fatty acidsulfonylorganic oxygen compoundorganic sulfonic acid or derivativesphenolhydrocarbon derivativeorganic nitrogen compoundorganic sulfonic acid amideorganooxygen compound |
|---|
