| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:51:35 UTC |
|---|
| Update Date | 2025-03-25 00:50:37 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02182127 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H9NO8S |
|---|
| Molecular Mass | 303.0049 |
|---|
| SMILES | O=C(O)CC(=Nc1ccccc1OS(=O)(=O)O)C(=O)O |
|---|
| InChI Key | GVZKKUPCGMKAPT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | arylsulfates |
|---|
| Direct Parent | phenylsulfates |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidsdicarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganopnictogen compoundsphenoxy compoundspropargyl-type 1,3-dipolar organic compoundssecondary ketiminessulfuric acid monoesters |
|---|
| Substituents | ketiminemonocyclic benzene moietysulfuric acid monoestercarbonyl groupcarboxylic acidiminecarboxylic acid derivativepropargyl-type 1,3-dipolar organic compoundphenylsulfatesecondary ketimineorganic oxideorganonitrogen compoundorganopnictogen compoundorganic 1,3-dipolar compoundaromatic homomonocyclic compoundorganic oxygen compounddicarboxylic acid or derivativessulfate-esterhydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compoundsulfuric acid esterorganooxygen compound |
|---|