| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:51:36 UTC |
|---|
| Update Date | 2025-03-25 00:50:38 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02182158 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H15NO7 |
|---|
| Molecular Mass | 357.0849 |
|---|
| SMILES | O=C(O)C1OC(Oc2ccc3c(c2)[nH]c2ccccc23)CC1(O)C(=O)O |
|---|
| InChI Key | QHOYFFAKGAJURF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | carbazoles |
|---|
| Direct Parent | carbazoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | acetalsalpha hydroxy acids and derivativesazacyclic compoundscarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativesindolesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsphenol etherspyrrolestertiary alcoholstetrahydrofurans |
|---|
| Substituents | phenol ethercarbonyl groupcarboxylic acidindolealpha-hydroxy acidmonosaccharidecarboxylic acid derivativesaccharideorganic oxideacetalaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundalcoholazacycletetrahydrofuranheteroaromatic compoundhydroxy acidcarbazoleoxacycletertiary alcoholorganic oxygen compoundpyrroledicarboxylic acid or derivativeshydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|
