| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:51:38 UTC |
|---|
| Update Date | 2025-03-25 00:50:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02182248 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H10N2O5S |
|---|
| Molecular Mass | 222.031 |
|---|
| SMILES | O=C(O)C1CCCC(NS(=O)(=O)O)=N1 |
|---|
| InChI Key | OKMZSOMGSJFYPU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | amidinesazacyclic compoundscarbonyl compoundscarboxylic acidshydrocarbon derivativesimidolactamsmonocarboxylic acids and derivativesorganic oxidesorganic sulfuric acids and derivativesorganopnictogen compoundspropargyl-type 1,3-dipolar organic compoundstetrahydropyridines |
|---|
| Substituents | carbonyl groupcarboxylic acidorganic sulfuric acid or derivativesazacycletetrahydropyridineorganic 1,3-dipolar compoundamidinepropargyl-type 1,3-dipolar organic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundaliphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundimidolactamorganoheterocyclic compoundorganooxygen compound |
|---|
