| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:51:38 UTC |
|---|
| Update Date | 2025-03-25 00:50:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02182251 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H13NO5 |
|---|
| Molecular Mass | 215.0794 |
|---|
| SMILES | O=C(O)C1CCC2C(C(O)CO)C(=O)N12 |
|---|
| InChI Key | ZHTYXNYMXSZVGB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | peptidomimetics |
|---|
| Subclass | hybrid peptides |
|---|
| Direct Parent | hybrid peptides |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diolsalpha amino acidsazacyclic compoundsazepanesazetidinescaprolactamscarbapenamscarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsprimary alcoholspyrrolidine carboxylic acidssecondary alcoholstertiary carboxylic acid amides |
|---|
| Substituents | caprolactamcarbonyl grouplactamcarboxylic acidalpha-amino acid or derivativescarboxylic acid derivativealiphatic heteropolycyclic compoundorganic oxidepyrrolidine carboxylic acidtertiary carboxylic acid amideorganonitrogen compoundalpha-amino acidorganopnictogen compoundpyrrolidineprimary alcoholcarbapenamorganoheterocyclic compound1,2-diolcyclic hybrid peptidealcoholazacyclecarboxamide groupazetidinemonocarboxylic acid or derivativespyrrolidine carboxylic acid or derivativesazepaneorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundbeta-lactamorganooxygen compound |
|---|
