Record Information |
---|
HMDB Status | expected |
---|
Creation Date | 2024-02-21 14:51:41 UTC |
---|
Update Date | 2025-03-25 00:50:39 UTC |
---|
HMDB ID | HMDB0042049 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02182345 |
---|
Name | Trichloroethanol glucuronide |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C8H11Cl3O7 |
---|
Molecular Mass | 323.957 |
---|
SMILES | O=C(O)C1OC(OCC(Cl)(Cl)Cl)C(O)C(O)C1O |
---|
InChI Key | IQOASJJGUQMXDW-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic oxygen compounds |
---|
Class | organooxygen compounds |
---|
Subclass | carbohydrates and carbohydrate conjugates |
---|
Direct Parent | o-glucuronides |
---|
Geometric Descriptor | aliphatic heteromonocyclic compounds |
---|
Alternative Parents | acetalsalkyl chloridesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsglucuronic acid derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganochloridesoxacyclic compoundsoxanespyran carboxylic acidssecondary alcohols |
---|
Substituents | carbonyl groupcarboxylic acidalkyl chlorideorganochlorideo-glucuronidemonosaccharidecarboxylic acid derivativeorganohalogen compoundpyran carboxylic acid1-o-glucuronidebeta-hydroxy acidorganic oxideacetalaliphatic heteromonocyclic compoundalkyl halideoxaneorganoheterocyclic compoundalcoholpyran carboxylic acid or derivativeshydroxy acidoxacyclemonocarboxylic acid or derivativespyransecondary alcoholhydrocarbon derivative |
---|