| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:51:41 UTC |
|---|
| Update Date | 2025-03-25 00:50:40 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02182349 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H20O12 |
|---|
| Molecular Mass | 368.0955 |
|---|
| SMILES | O=C(O)C1OC(OC2CC(O)(C(=O)O)CC(O)C2O)OC(CO)C1O |
|---|
| InChI Key | FEXNJTKXTYHWPU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | quinic acids and derivatives |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,3-dioxanesalpha hydroxy acids and derivativesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acid orthoesterscarboxylic acidscyclohexanolsdicarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesortho estersoxacyclic compoundsprimary alcoholstertiary alcohols |
|---|
| Substituents | carbonyl groupcarboxylic acidortho esteralpha-hydroxy acidcarboxylic acid orthoestercarboxylic acid derivativebeta-hydroxy acidorganic oxidealiphatic heteromonocyclic compoundorthocarboxylic acid derivativeprimary alcoholorganoheterocyclic compoundcyclohexanolhydroxy acidoxacycletertiary alcoholsecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativemeta-dioxanequinic acid |
|---|