| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:51:42 UTC |
|---|
| Update Date | 2025-03-25 00:50:40 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02182399 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H19ClO10 |
|---|
| Molecular Mass | 358.0667 |
|---|
| SMILES | O=C(O)C1OC(OC2(CCl)CC(O)C(O)C2O)C(O)C(O)C1O |
|---|
| InChI Key | OTAALEKXYOJAFL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | o-glucuronides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsalkyl chloridesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidscyclitols and derivativescyclopentanolsglucuronic acid derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganochloridesoxacyclic compoundsoxanespyran carboxylic acids |
|---|
| Substituents | carbonyl groupcarboxylic acidalkyl chlorideorganochlorideo-glucuronidemonosaccharidecarboxylic acid derivativeorganohalogen compoundpyran carboxylic acid1-o-glucuronidebeta-hydroxy acidorganic oxideacetalaliphatic heteromonocyclic compoundalkyl halideoxaneorganoheterocyclic compoundalcoholpyran carboxylic acid or derivativescyclitol or derivativeshydroxy acidcyclic alcoholcyclopentanoloxacyclemonocarboxylic acid or derivativespyransecondary alcoholhydrocarbon derivative |
|---|