| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:51:43 UTC |
|---|
| Update Date | 2025-03-25 00:50:40 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02182436 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H13O15P3 |
|---|
| Molecular Mass | 405.9467 |
|---|
| SMILES | O=P(O)(O)OC1OC(CO)C(O)(OP(=O)(O)O)C1OP(=O)(O)O |
|---|
| InChI Key | BIDYNZHESVPIGD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | monoalkyl phosphates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | hydrocarbon derivativesmonosaccharidesorganic oxidesoxacyclic compoundsprimary alcoholstetrahydrofurans |
|---|
| Substituents | alcoholtetrahydrofuranmonosaccharideoxacyclesaccharideorganic oxideorganic oxygen compoundmonoalkyl phosphatealiphatic heteromonocyclic compoundhydrocarbon derivativeprimary alcoholorganoheterocyclic compoundorganooxygen compound |
|---|