| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:51:43 UTC |
|---|
| Update Date | 2025-03-25 00:50:41 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02182452 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H11O11PS |
|---|
| Molecular Mass | 309.976 |
|---|
| SMILES | O=P(O)(O)OC1C(O)OC(CO)C1OS(=O)(=O)O |
|---|
| InChI Key | GNGSKTHEMALBKW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | monoalkyl phosphates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkyl sulfateshemiacetalshydrocarbon derivativesorganic oxidesoxacyclic compoundsprimary alcoholssulfuric acid monoesterstetrahydrofurans |
|---|
| Substituents | alcoholsulfuric acid monoesterorganic sulfuric acid or derivativestetrahydrofuranoxacycleorganic oxideorganic oxygen compoundmonoalkyl phosphatealkyl sulfatealiphatic heteromonocyclic compoundsulfate-esterhemiacetalhydrocarbon derivativesulfuric acid esterprimary alcoholorganoheterocyclic compoundorganooxygen compound |
|---|