| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:51:44 UTC |
|---|
| Update Date | 2025-03-25 00:50:41 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02182469 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H13N3O5 |
|---|
| Molecular Mass | 243.0855 |
|---|
| SMILES | O=CCc1cn(C2OC(CO)C(O)C2O)nn1 |
|---|
| InChI Key | BATMJGGGDWZXKO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | triazole ribonucleosides and ribonucleotides |
|---|
| Subclass | triazole ribonucleosides and ribonucleotides |
|---|
| Direct Parent | triazole ribonucleosides and ribonucleotides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha-hydrogen aldehydesazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary alcoholssecondary alcoholstetrahydrofuranstriazoles |
|---|
| Substituents | n-ribosyl-1,2,3-triazoletriazolecarbonyl grouparomatic heteromonocyclic compoundmonosaccharidesaccharideorganic oxideorganonitrogen compoundorganopnictogen compoundprimary alcohol1,2,3-triazoleorganoheterocyclic compoundazolealcoholazacycletetrahydrofuranheteroaromatic compoundaldehydeoxacycleorganic oxygen compoundalpha-hydrogen aldehydesecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|