| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:51:44 UTC |
|---|
| Update Date | 2025-03-25 00:50:40 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02182473 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H12NO8P |
|---|
| Molecular Mass | 257.0301 |
|---|
| SMILES | O=CNC(COP(=O)(O)O)C(O)C(O)C=O |
|---|
| InChI Key | FHIBOBWCFRKWPJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | phosphoethanolamines |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | 1,2-diolsalpha-hydroxyaldehydesbeta-hydroxy aldehydescarboxylic acids and derivativeshydrocarbon derivativesmonoalkyl phosphatesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | aliphatic acyclic compoundbeta-hydroxy aldehydecarbonyl groupmonosaccharidecarboxylic acid derivativephosphoethanolaminesaccharideorganic oxidealpha-hydroxyaldehydeorganonitrogen compoundorganopnictogen compound1,2-diolalcoholaldehydecarboxamide groupsecondary carboxylic acid amideorganic oxygen compoundmonoalkyl phosphatesecondary alcoholhydrocarbon derivativeorganic nitrogen compoundalkyl phosphateorganooxygen compound |
|---|
