| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:51:45 UTC |
|---|
| Update Date | 2025-03-25 00:50:41 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02182500 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H10N2O3 |
|---|
| Molecular Mass | 230.0691 |
|---|
| SMILES | O=CNc1ccccc1NC(=O)c1ccco1 |
|---|
| InChI Key | FANPQLASKHCLHL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | 2-furanilides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 2-heteroaryl carboxamidescarbonyl compoundscarboxylic acids and derivativesfuroic acid and derivativesheteroaromatic compoundshydrocarbon derivativesn-arylamidesorganic oxidesorganopnictogen compoundsoxacyclic compoundssecondary carboxylic acid amides |
|---|
| Substituents | furancarbonyl grouparomatic heteromonocyclic compoundn-arylamidecarboxylic acid derivative2-heteroaryl carboxamideorganic oxide2-furanilideorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundfuroic acid or derivativesheteroaromatic compoundcarboxamide groupoxacyclesecondary carboxylic acid amideorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
