| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:51:45 UTC |
|---|
| Update Date | 2025-03-25 00:50:41 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02182503 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H10O3 |
|---|
| Molecular Mass | 238.063 |
|---|
| SMILES | O=Cc1c(O)c(O)cc2c1ccc1ccccc12 |
|---|
| InChI Key | DVBVBBJPNIQFNQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenanthrenes and derivatives |
|---|
| Subclass | phenanthrols |
|---|
| Direct Parent | phenanthrols |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsaryl-aldehydeshydrocarbon derivativesnaphthalenecarboxylic acidsnaphthols and derivativesorganic oxidesorganooxygen compoundsvinylogous acids |
|---|
| Substituents | phenanthrol1-hydroxy-2-unsubstituted benzenoidaldehydearomatic homopolycyclic compound1-naphthalenecarboxylic acidvinylogous acidorganic oxidearyl-aldehydenaphthaleneorganic oxygen compound1-naphthalenecarboxylic acid or derivativeshydrocarbon derivative2-naphtholorganooxygen compound |
|---|
