| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:51:45 UTC |
|---|
| Update Date | 2025-03-25 00:50:41 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02182505 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H6NO4 |
|---|
| Molecular Mass | 180.0297 |
|---|
| SMILES | O=C[N+]([O-])c1cccc(C(=O)O)c1 |
|---|
| InChI Key | SLPOHNPPAQGRPQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | acylaminobenzoic acid and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | anilidesbenzoic acidsbenzoyl derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganic oxoanionic compoundsorganonitrogen compoundsorganopnictogen compounds |
|---|
| Substituents | carbonyl groupacylaminobenzoic acid or derivativescarboxylic acidbenzoylcarboxylic acid derivativearomatic homomonocyclic compoundanilideorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundbenzoic acidorganooxygen compoundorganic hyponitrite |
|---|