| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:51:45 UTC |
|---|
| Update Date | 2025-03-25 00:50:41 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02182526 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H12O9P2 |
|---|
| Molecular Mass | 277.9957 |
|---|
| SMILES | O=P(O)(O)OP1(=O)OCC(CO)C(O)C1O |
|---|
| InChI Key | BPRSUCAYPIGSLD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | organic phosphoric acids and derivatives |
|---|
| Direct Parent | organic phosphoric acids and derivatives |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | hydrocarbon derivativesorganic oxidesorganopnictogen compoundsoxacyclic compoundsphosphacyclic compoundsphosphonic acid estersprimary alcoholssecondary alcohols |
|---|
| Substituents | alcoholphosphacyclephosphonic acid esteroxacycleorganic oxideorganic oxygen compoundaliphatic heteromonocyclic compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeprimary alcoholorganic phosphoric acid derivativeorganophosphonic acid derivativeorganoheterocyclic compoundorganooxygen compound |
|---|
