| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:51:46 UTC |
|---|
| Update Date | 2025-03-25 00:50:41 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02182546 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H7ClO3S |
|---|
| Molecular Mass | 217.9804 |
|---|
| SMILES | O=S(=O)(O)C(Cl)=Cc1ccccc1 |
|---|
| InChI Key | IMRIYYYRLGPJNM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzene and substituted derivatives |
|---|
| Direct Parent | benzene and substituted derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | chloroalkeneshydrocarbon derivativesorganic oxidesorganochloridesorganosulfonic acidssulfonylsvinyl chlorides |
|---|
| Substituents | organosulfonic acid or derivativesmonocyclic benzene moietychloroalkeneorganochlorideorganosulfonic acidorganosulfur compoundorganohalogen compoundaromatic homomonocyclic compoundorganic oxidesulfonylorganic oxygen compoundorganic sulfonic acid or derivativesvinyl halidehaloalkenehydrocarbon derivativevinyl chloride |
|---|
